C18H19Cl2FN2O2 — CID 123525561
3-[(3,5-dichloro-2-pyridinyl)oxy]-1-[2-(4-fluorophenyl)ethylamino]pentan-2-one (PubChem CID 123525561) has the molecular formula C18H19Cl2FN2O2 and a molecular weight of 385.27 g/mol. Its IUPAC name is 3-[(3,5-dichloro-2-pyridinyl)oxy]-1-[2-(4-fluorophenyl)ethylamino]pentan-2-one.
| Compound Name | 3-[(3,5-dichloro-2-pyridinyl)oxy]-1-[2-(4-fluorophenyl)ethylamino]pentan-2-one |
|---|---|
| PubChem CID | 123525561 |
| Molecular Formula | C18H19Cl2FN2O2 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 3-[(3,5-dichloro-2-pyridinyl)oxy]-1-[2-(4-fluorophenyl)ethylamino]pentan-2-one |
| SMILES | CCC(Oc1ncc(Cl)cc1Cl)C(=O)CNCCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H19Cl2FN2O2/c1-2-17(25-18-15(20)9-13(19)10-23-18)16(24)11-22-8-7-12-3-5-14(21)6-4-12/h3-6,9-10,17,22H,2,7-8,11H2,1H3 |
| InChIKey | XJTGUCSOZMXSGN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|