C5H7F2NO2 — CID 123526461
(3,4-difluoropyrrolidin-1-yl) formate (PubChem CID 123526461) has the molecular formula C5H7F2NO2 and a molecular weight of 151.11 g/mol. Its IUPAC name is (3,4-difluoropyrrolidin-1-yl) formate.
| Compound Name | (3,4-difluoropyrrolidin-1-yl) formate |
|---|---|
| PubChem CID | 123526461 |
| Molecular Formula | C5H7F2NO2 |
| Molecular Weight | 151.11 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | (3,4-difluoropyrrolidin-1-yl) formate |
| SMILES | O=CON1CC(F)C(F)C1 |
| InChI | InChI=1S/C5H7F2NO2/c6-4-1-8(10-3-9)2-5(4)7/h3-5H,1-2H2 |
| InChIKey | AIVLOEHBELOITC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.11 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|