C5H8F2N- — CID 123412540
(3R,4R)-3,4-difluoro-1-methanidylpyrrolidine (PubChem CID 123412540) has the molecular formula C5H8F2N- and a molecular weight of 120.12 g/mol. Its IUPAC name is (3R,4R)-3,4-difluoro-1-methanidylpyrrolidine.
| Compound Name | (3R,4R)-3,4-difluoro-1-methanidylpyrrolidine |
|---|---|
| PubChem CID | 123412540 |
| Molecular Formula | C5H8F2N- |
| Molecular Weight | 120.12 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | (3R,4R)-3,4-difluoro-1-methanidylpyrrolidine |
| SMILES | [CH2-]N1C[C@@H](F)[C@H](F)C1 |
| InChI | InChI=1S/C5H8F2N/c1-8-2-4(6)5(7)3-8/h4-5H,1-3H2/q-1/t4-,5-/m1/s1 |
| InChIKey | KDAUXDLVEIYCPP-RFZPGFLSSA-N |
| XLogP | 0.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.12 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|