C32H54N2O2 — CID 123527262
9-[1-[1-[2-(dimethylamino)ethyl]-5-methylpiperidin-2-yl]ethyl]-11,12b-dimethyl-1,2,3,4,6,6a,6b,7,8,10,12,12a-dodecahydronaphtho[2,1-a]azulene-3,9-diol (PubChem CID 123527262) has the molecular formula C32H54N2O2 and a molecular weight of 498.80 g/mol. Its IUPAC name is 9-[1-[1-[2-(dimethylamino)ethyl]-5-methylpiperidin-2-yl]ethyl]-11,12b-dimethyl-1,2,3,4,6,6a,6b,7,8,10,12,12a-dodecahydronaphtho[2,1-a]azulene-3,9-diol.
| Compound Name | 9-[1-[1-[2-(dimethylamino)ethyl]-5-methylpiperidin-2-yl]ethyl]-11,12b-dimethyl-1,2,3,4,6,6a,6b,7,8,10,12,12a-dodecahydronaphtho[2,1-a]azulene-3,9-diol |
|---|---|
| PubChem CID | 123527262 |
| Molecular Formula | C32H54N2O2 |
| Molecular Weight | 498.80 g/mol |
| Exact Mass | 498.42 |
| IUPAC Name | 9-[1-[1-[2-(dimethylamino)ethyl]-5-methylpiperidin-2-yl]ethyl]-11,12b-dimethyl-1,2,3,4,6,6a,6b,7,8,10,12,12a-dodecahydronaphtho[2,1-a]azulene-3,9-diol |
| SMILES | CC1=C2CC3C(CC=C4CC(O)CCC43C)C2CCC(O)(C(C)C2CCC(C)CN2CCN(C)C)C1 |
| InChI | InChI=1S/C32H54N2O2/c1-21-7-10-30(34(20-21)16-15-33(5)6)23(3)32(36)14-12-26-27-9-8-24-17-25(35)11-13-31(24,4)29(27)18-28(26)22(2)19-32/h8,21,23,25-27,29-30,35-36H,7,9-20H2,1-6H3 |
| InChIKey | ITRWNKBMYZWRIP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.80 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|