C10H7N5 — CID 123529033
5-pyridin-4-yl-3H-imidazo[4,5-b]pyrazine (PubChem CID 123529033) has the molecular formula C10H7N5 and a molecular weight of 197.20 g/mol. Its IUPAC name is 5-pyridin-4-yl-3H-imidazo[4,5-b]pyrazine.
| Compound Name | 5-pyridin-4-yl-3H-imidazo[4,5-b]pyrazine |
|---|---|
| PubChem CID | 123529033 |
| Molecular Formula | C10H7N5 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 5-pyridin-4-yl-3H-imidazo[4,5-b]pyrazine |
| SMILES | c1cc(-c2cnc3nc[nH]c3n2)ccn1 |
| InChI | InChI=1S/C10H7N5/c1-3-11-4-2-7(1)8-5-12-9-10(15-8)14-6-13-9/h1-6H,(H,12,13,14,15) |
| InChIKey | FEZUSIOMGKZQNT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |