C13H7I2N3 — CID 11753926
5,8-diiodo-2-pyridin-4-ylquinoxaline (PubChem CID 11753926) has the molecular formula C13H7I2N3 and a molecular weight of 459.03 g/mol. Its IUPAC name is 5,8-diiodo-2-pyridin-4-ylquinoxaline.
| Compound Name | 5,8-diiodo-2-pyridin-4-ylquinoxaline |
|---|---|
| PubChem CID | 11753926 |
| Molecular Formula | C13H7I2N3 |
| Molecular Weight | 459.03 g/mol |
| Exact Mass | 458.87 |
| IUPAC Name | 5,8-diiodo-2-pyridin-4-ylquinoxaline |
| SMILES | Ic1ccc(I)c2nc(-c3ccncc3)cnc12 |
| InChI | InChI=1S/C13H7I2N3/c14-9-1-2-10(15)13-12(9)17-7-11(18-13)8-3-5-16-6-4-8/h1-7H |
| InChIKey | SPTAZHATUOZPSN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.03 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|