About S-(3-methylhexyl) ethanethioate
S-(3-methylhexyl) ethanethioate (PubChem CID 123530328) has the molecular formula C9H18OS
and a molecular weight of 174.31 g/mol. Its IUPAC name is S-(3-methylhexyl) ethanethioate.
Molecular Properties
| Compound Name | S-(3-methylhexyl) ethanethioate |
| PubChem CID | 123530328 |
| Molecular Formula | C9H18OS |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | S-(3-methylhexyl) ethanethioate |
| SMILES | CCCC(C)CCSC(C)=O |
| InChI | InChI=1S/C9H18OS/c1-4-5-8(2)6-7-11-9(3)10/h8H,4-7H2,1-3H3 |
| InChIKey | ZYHMNMGIDBFLNH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3-methylhexyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3-methylhexyl) ethanethioate?
The IUPAC name of S-(3-methylhexyl) ethanethioate (CID 123530328) is S-(3-methylhexyl) ethanethioate.
What is the SMILES notation for S-(3-methylhexyl) ethanethioate?
The canonical SMILES for S-(3-methylhexyl) ethanethioate is CCCC(C)CCSC(C)=O.
What is the InChIKey of S-(3-methylhexyl) ethanethioate?
The InChIKey is ZYHMNMGIDBFLNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18OS/c1-4-5-8(2)6-7-11-9(3)10/h8H,4-7H2,1-3H3.
What are the key properties of S-(3-methylhexyl) ethanethioate?
S-(3-methylhexyl) ethanethioate has a molecular weight of 174.31 g/mol, XLogP of 3.09, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3-methylhexyl) ethanethioate is sourced from PubChem (CID 123530328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).