About S-(3-hydroxypentyl) ethanethioate
S-(3-hydroxypentyl) ethanethioate (PubChem CID 130124835) has the molecular formula C7H14O2S
and a molecular weight of 162.25 g/mol. Its IUPAC name is S-(3-hydroxypentyl) ethanethioate.
Molecular Properties
| Compound Name | S-(3-hydroxypentyl) ethanethioate |
| PubChem CID | 130124835 |
| Molecular Formula | C7H14O2S |
| Molecular Weight | 162.25 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | S-(3-hydroxypentyl) ethanethioate |
| SMILES | CCC(O)CCSC(C)=O |
| InChI | InChI=1S/C7H14O2S/c1-3-7(9)4-5-10-6(2)8/h7,9H,3-5H2,1-2H3 |
| InChIKey | FLCGNOWGEWHUNF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3-hydroxypentyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3-hydroxypentyl) ethanethioate?
The IUPAC name of S-(3-hydroxypentyl) ethanethioate (CID 130124835) is S-(3-hydroxypentyl) ethanethioate.
What is the SMILES notation for S-(3-hydroxypentyl) ethanethioate?
The canonical SMILES for S-(3-hydroxypentyl) ethanethioate is CCC(O)CCSC(C)=O.
What is the InChIKey of S-(3-hydroxypentyl) ethanethioate?
The InChIKey is FLCGNOWGEWHUNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2S/c1-3-7(9)4-5-10-6(2)8/h7,9H,3-5H2,1-2H3.
What are the key properties of S-(3-hydroxypentyl) ethanethioate?
S-(3-hydroxypentyl) ethanethioate has a molecular weight of 162.25 g/mol, XLogP of 1.43, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3-hydroxypentyl) ethanethioate is sourced from PubChem (CID 130124835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).