C21H39FN2 — CID 123531742
7-butan-2-yl-5-ethyl-8-fluoro-10-methylidene-1-(methylideneamino)tridec-11-en-1-amine (PubChem CID 123531742) has the molecular formula C21H39FN2 and a molecular weight of 338.56 g/mol. Its IUPAC name is 7-butan-2-yl-5-ethyl-8-fluoro-10-methylidene-1-(methylideneamino)tridec-11-en-1-amine.
| Compound Name | 7-butan-2-yl-5-ethyl-8-fluoro-10-methylidene-1-(methylideneamino)tridec-11-en-1-amine |
|---|---|
| PubChem CID | 123531742 |
| Molecular Formula | C21H39FN2 |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.31 |
| IUPAC Name | 7-butan-2-yl-5-ethyl-8-fluoro-10-methylidene-1-(methylideneamino)tridec-11-en-1-amine |
| SMILES | C=NC(N)CCCC(CC)CC(C(C)CC)C(F)CC(=C)C=CC |
| InChI | InChI=1S/C21H39FN2/c1-7-11-16(4)14-20(22)19(17(5)8-2)15-18(9-3)12-10-13-21(23)24-6/h7,11,17-21H,4,6,8-10,12-15,23H2,1-3,5H3 |
| InChIKey | XAPDLSGUQBHIKL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|