C27H29F2N5O3S — CID 123539042
N-[5-(2-amino-3-cyclopentylbenzimidazol-5-yl)-2-butoxy-3-pyridinyl]-2,4-difluorobenzenesulfonamide (PubChem CID 123539042) has the molecular formula C27H29F2N5O3S and a molecular weight of 541.62 g/mol. Its IUPAC name is N-[5-(2-amino-3-cyclopentylbenzimidazol-5-yl)-2-butoxy-3-pyridinyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[5-(2-amino-3-cyclopentylbenzimidazol-5-yl)-2-butoxy-3-pyridinyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 123539042 |
| Molecular Formula | C27H29F2N5O3S |
| Molecular Weight | 541.62 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | N-[5-(2-amino-3-cyclopentylbenzimidazol-5-yl)-2-butoxy-3-pyridinyl]-2,4-difluorobenzenesulfonamide |
| SMILES | CCCCOc1ncc(-c2ccc3nc(N)n(C4CCCC4)c3c2)cc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C27H29F2N5O3S/c1-2-3-12-37-26-23(33-38(35,36)25-11-9-19(28)15-21(25)29)13-18(16-31-26)17-8-10-22-24(14-17)34(27(30)32-22)20-6-4-5-7-20/h8-11,13-16,20,33H,2-7,12H2,1H3,(H2,30,32) |
| InChIKey | YMTMNTUNIRVFHH-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|