C10H17N — CID 123539478
4-ethyl-3,5-dimethylcyclohex-2-en-1-imine (PubChem CID 123539478) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 4-ethyl-3,5-dimethylcyclohex-2-en-1-imine.
| Compound Name | 4-ethyl-3,5-dimethylcyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 123539478 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 4-ethyl-3,5-dimethylcyclohex-2-en-1-imine |
| SMILES | [H]/N=C1\C=C(C)C(CC)C(C)C1 |
| InChI | InChI=1S/C10H17N/c1-4-10-7(2)5-9(11)6-8(10)3/h5,8,10-11H,4,6H2,1-3H3/b11-9+ |
| InChIKey | ABVDORZQBMNMKV-PKNBQFBNSA-N |
| XLogP | 3.02 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|