C8H14N2 — CID 123662086
4,5-dimethylcyclohexane-1,2-diimine (PubChem CID 123662086) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 4,5-dimethylcyclohexane-1,2-diimine.
| Compound Name | 4,5-dimethylcyclohexane-1,2-diimine |
|---|---|
| PubChem CID | 123662086 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 4,5-dimethylcyclohexane-1,2-diimine |
| SMILES | [H]/N=C1\CC(C)C(C)C\C1=N/[H] |
| InChI | InChI=1S/C8H14N2/c1-5-3-7(9)8(10)4-6(5)2/h5-6,9-10H,3-4H2,1-2H3/b9-7+,10-8+ |
| InChIKey | BVFYHTBEOZMFQE-FIFLTTCUSA-N |
| XLogP | 2.09 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|