C9H9Br2NO2 — CID 123542330
1,5-dibromo-3-methoxy-2-(1-nitrosoethyl)benzene (PubChem CID 123542330) has the molecular formula C9H9Br2NO2 and a molecular weight of 322.98 g/mol. Its IUPAC name is 1,5-dibromo-3-methoxy-2-(1-nitrosoethyl)benzene.
| Compound Name | 1,5-dibromo-3-methoxy-2-(1-nitrosoethyl)benzene |
|---|---|
| PubChem CID | 123542330 |
| Molecular Formula | C9H9Br2NO2 |
| Molecular Weight | 322.98 g/mol |
| Exact Mass | 320.90 |
| IUPAC Name | 1,5-dibromo-3-methoxy-2-(1-nitrosoethyl)benzene |
| SMILES | COc1cc(Br)cc(Br)c1C(C)N=O |
| InChI | InChI=1S/C9H9Br2NO2/c1-5(12-13)9-7(11)3-6(10)4-8(9)14-2/h3-5H,1-2H3 |
| InChIKey | QUONIAHTHAPGLP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.98 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |