C20H32N2O5S — CID 123543186
tert-butyl N-[2-[[2-methyl-2-(4-propylsulfonylphenyl)propanoyl]amino]ethyl]carbamate (PubChem CID 123543186) has the molecular formula C20H32N2O5S and a molecular weight of 412.55 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-methyl-2-(4-propylsulfonylphenyl)propanoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-methyl-2-(4-propylsulfonylphenyl)propanoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 123543186 |
| Molecular Formula | C20H32N2O5S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | tert-butyl N-[2-[[2-methyl-2-(4-propylsulfonylphenyl)propanoyl]amino]ethyl]carbamate |
| SMILES | CCCS(=O)(=O)c1ccc(C(C)(C)C(=O)NCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H32N2O5S/c1-7-14-28(25,26)16-10-8-15(9-11-16)20(5,6)17(23)21-12-13-22-18(24)27-19(2,3)4/h8-11H,7,12-14H2,1-6H3,(H,21,23)(H,22,24) |
| InChIKey | KOKWCWPXTABPER-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|