C23H31Cl4N3O5 — CID 123548950
[[3-tert-butyl-1-[4-chloro-3-[2-(oxan-2-yloxy)ethoxy]phenyl]pyrazol-5-yl]amino]-(2,2,2-trichloroethoxy)methanol (PubChem CID 123548950) has the molecular formula C23H31Cl4N3O5 and a molecular weight of 571.33 g/mol. Its IUPAC name is [[3-tert-butyl-1-[4-chloro-3-[2-(oxan-2-yloxy)ethoxy]phenyl]pyrazol-5-yl]amino]-(2,2,2-trichloroethoxy)methanol.
| Compound Name | [[3-tert-butyl-1-[4-chloro-3-[2-(oxan-2-yloxy)ethoxy]phenyl]pyrazol-5-yl]amino]-(2,2,2-trichloroethoxy)methanol |
|---|---|
| PubChem CID | 123548950 |
| Molecular Formula | C23H31Cl4N3O5 |
| Molecular Weight | 571.33 g/mol |
| Exact Mass | 569.10 |
| IUPAC Name | [[3-tert-butyl-1-[4-chloro-3-[2-(oxan-2-yloxy)ethoxy]phenyl]pyrazol-5-yl]amino]-(2,2,2-trichloroethoxy)methanol |
| SMILES | CC(C)(C)c1cc(NC(O)OCC(Cl)(Cl)Cl)n(-c2ccc(Cl)c(OCCOC3CCCCO3)c2)n1 |
| InChI | InChI=1S/C23H31Cl4N3O5/c1-22(2,3)18-13-19(28-21(31)35-14-23(25,26)27)30(29-18)15-7-8-16(24)17(12-15)32-10-11-34-20-6-4-5-9-33-20/h7-8,12-13,20-21,28,31H,4-6,9-11,14H2,1-3H3 |
| InChIKey | QYXQJOIUBDZAQB-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.33 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|