C35H52F2N2O4 — CID 123550352
12-amino-8-[[(3,5-difluorophenyl)methyl-(1-hydroxyethyl)amino]methyl]-4,6,17,17-tetramethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-11,18-diol (PubChem CID 123550352) has the molecular formula C35H52F2N2O4 and a molecular weight of 602.81 g/mol. Its IUPAC name is 12-amino-8-[[(3,5-difluorophenyl)methyl-(1-hydroxyethyl)amino]methyl]-4,6,17,17-tetramethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-11,18-diol.
| Compound Name | 12-amino-8-[[(3,5-difluorophenyl)methyl-(1-hydroxyethyl)amino]methyl]-4,6,17,17-tetramethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-11,18-diol |
|---|---|
| PubChem CID | 123550352 |
| Molecular Formula | C35H52F2N2O4 |
| Molecular Weight | 602.81 g/mol |
| Exact Mass | 602.39 |
| IUPAC Name | 12-amino-8-[[(3,5-difluorophenyl)methyl-(1-hydroxyethyl)amino]methyl]-4,6,17,17-tetramethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-11,18-diol |
| SMILES | CC1CC(CN(Cc2cc(F)cc(F)c2)C(C)O)OC2C1C1(C)CCC34CC35CCC(O)C(C)(C)C5CCC4C1(N)C2O |
| InChI | InChI=1S/C35H52F2N2O4/c1-19-12-24(17-39(20(2)40)16-21-13-22(36)15-23(37)14-21)43-29-28(19)32(5)10-11-34-18-33(34)9-8-27(41)31(3,4)25(33)6-7-26(34)35(32,38)30(29)42/h13-15,19-20,24-30,40-42H,6-12,16-18,38H2,1-5H3 |
| InChIKey | LVVCBGFUAGSKJB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.81 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|