C11H18N2 — CID 123556060
N,N-dimethyl-4-(2-methyliminoethyl)cyclohexa-2,4-dien-1-amine (PubChem CID 123556060) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-methyliminoethyl)cyclohexa-2,4-dien-1-amine.
| Compound Name | N,N-dimethyl-4-(2-methyliminoethyl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 123556060 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N,N-dimethyl-4-(2-methyliminoethyl)cyclohexa-2,4-dien-1-amine |
| SMILES | C/N=C/CC1=CCC(N(C)C)C=C1 |
| InChI | InChI=1S/C11H18N2/c1-12-9-8-10-4-6-11(7-5-10)13(2)3/h4-6,9,11H,7-8H2,1-3H3/b12-9+ |
| InChIKey | ARAVCKMZWQTSPE-FMIVXFBMSA-N |
| XLogP | 1.89 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|