C16H18O7 — CID 123562286
1,4-dihydroxy-3-[1-hydroxy-3-(4-hydroxyphenyl)prop-2-enoxy]-6-oxabicyclo[3.2.1]octan-7-one (PubChem CID 123562286) has the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. Its IUPAC name is 1,4-dihydroxy-3-[1-hydroxy-3-(4-hydroxyphenyl)prop-2-enoxy]-6-oxabicyclo[3.2.1]octan-7-one.
| Compound Name | 1,4-dihydroxy-3-[1-hydroxy-3-(4-hydroxyphenyl)prop-2-enoxy]-6-oxabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 123562286 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1,4-dihydroxy-3-[1-hydroxy-3-(4-hydroxyphenyl)prop-2-enoxy]-6-oxabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1OC2CC1(O)CC(OC(O)C=Cc1ccc(O)cc1)C2O |
| InChI | InChI=1S/C16H18O7/c17-10-4-1-9(2-5-10)3-6-13(18)22-11-7-16(21)8-12(14(11)19)23-15(16)20/h1-6,11-14,17-19,21H,7-8H2 |
| InChIKey | NPTFAUWKTRVIES-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|