C25H31N3O5 — CID 123562767
tert-butyl 2-[[6-(2-methoxyethyl)-5-oxobenzo[c][2,7]naphthyridin-8-yl]oxymethyl]-4-methylazetidine-1-carboxylate (PubChem CID 123562767) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is tert-butyl 2-[[6-(2-methoxyethyl)-5-oxobenzo[c][2,7]naphthyridin-8-yl]oxymethyl]-4-methylazetidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[6-(2-methoxyethyl)-5-oxobenzo[c][2,7]naphthyridin-8-yl]oxymethyl]-4-methylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 123562767 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | tert-butyl 2-[[6-(2-methoxyethyl)-5-oxobenzo[c][2,7]naphthyridin-8-yl]oxymethyl]-4-methylazetidine-1-carboxylate |
| SMILES | COCCn1c(=O)c2cnccc2c2ccc(OCC3CC(C)N3C(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C25H31N3O5/c1-16-12-17(28(16)24(30)33-25(2,3)4)15-32-18-6-7-20-19-8-9-26-14-21(19)23(29)27(10-11-31-5)22(20)13-18/h6-9,13-14,16-17H,10-12,15H2,1-5H3 |
| InChIKey | NQWMYVSIJDEKFG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|