C25H25FN4O2S — CID 123567826
N-[3-(3-fluorophenoxy)-4-(3-iminobutylideneamino)phenyl]-2-[4-(methylaminosulfanyl)phenyl]acetamide (PubChem CID 123567826) has the molecular formula C25H25FN4O2S and a molecular weight of 464.57 g/mol. Its IUPAC name is N-[3-(3-fluorophenoxy)-4-(3-iminobutylideneamino)phenyl]-2-[4-(methylaminosulfanyl)phenyl]acetamide.
| Compound Name | N-[3-(3-fluorophenoxy)-4-(3-iminobutylideneamino)phenyl]-2-[4-(methylaminosulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 123567826 |
| Molecular Formula | C25H25FN4O2S |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N-[3-(3-fluorophenoxy)-4-(3-iminobutylideneamino)phenyl]-2-[4-(methylaminosulfanyl)phenyl]acetamide |
| SMILES | [H]/N=C(\C)C/C=N/c1ccc(NC(=O)Cc2ccc(SNC)cc2)cc1Oc1cccc(F)c1 |
| InChI | InChI=1S/C25H25FN4O2S/c1-17(27)12-13-29-23-11-8-20(16-24(23)32-21-5-3-4-19(26)15-21)30-25(31)14-18-6-9-22(10-7-18)33-28-2/h3-11,13,15-16,27-28H,12,14H2,1-2H3,(H,30,31)/b27-17+,29-13+ |
| InChIKey | YEQLYKQKOKCVFR-OILVQLJCSA-N |
| XLogP | 6.16 |
| TPSA | 86.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|