C6H6N4O2 — CID 123568857
3,6-diamino-[1,3]oxazolo[4,5-b]pyridin-2-one (PubChem CID 123568857) has the molecular formula C6H6N4O2 and a molecular weight of 166.14 g/mol. Its IUPAC name is 3,6-diamino-[1,3]oxazolo[4,5-b]pyridin-2-one.
| Compound Name | 3,6-diamino-[1,3]oxazolo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 123568857 |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 3,6-diamino-[1,3]oxazolo[4,5-b]pyridin-2-one |
| SMILES | Nc1cnc2c(c1)oc(=O)n2N |
| InChI | InChI=1S/C6H6N4O2/c7-3-1-4-5(9-2-3)10(8)6(11)12-4/h1-2H,7-8H2 |
| InChIKey | CXZQIWBPEHYOTL-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 100.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |