C15H21N7O2 — CID 123571226
tert-butyl N-amino-N-[6-(1-imino-3-methyliminopropan-2-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]carbamate (PubChem CID 123571226) has the molecular formula C15H21N7O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is tert-butyl N-amino-N-[6-(1-imino-3-methyliminopropan-2-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]carbamate.
| Compound Name | tert-butyl N-amino-N-[6-(1-imino-3-methyliminopropan-2-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]carbamate |
|---|---|
| PubChem CID | 123571226 |
| Molecular Formula | C15H21N7O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | tert-butyl N-amino-N-[6-(1-imino-3-methyliminopropan-2-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]carbamate |
| SMILES | [H]/N=C/C(/C=N/C)c1cc2nc(N(N)C(=O)OC(C)(C)C)cnc2[nH]1 |
| InChI | InChI=1S/C15H21N7O2/c1-15(2,3)24-14(23)22(17)12-8-19-13-11(20-12)5-10(21-13)9(6-16)7-18-4/h5-9,16H,17H2,1-4H3,(H,19,21)/b16-6+,18-7+ |
| InChIKey | ZTXHHHMYVZBKMD-OOJUJLKASA-N |
| XLogP | 2.01 |
| TPSA | 133.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|