C18H29N5O2 — CID 123201485
tert-butyl N-amino-N-[5-ethanimidoyl-4-propan-2-yl-6-(prop-2-enylamino)-2-pyridinyl]carbamate (PubChem CID 123201485) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is tert-butyl N-amino-N-[5-ethanimidoyl-4-propan-2-yl-6-(prop-2-enylamino)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-amino-N-[5-ethanimidoyl-4-propan-2-yl-6-(prop-2-enylamino)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 123201485 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | tert-butyl N-amino-N-[5-ethanimidoyl-4-propan-2-yl-6-(prop-2-enylamino)-2-pyridinyl]carbamate |
| SMILES | [H]/N=C(\C)c1c(C(C)C)cc(N(N)C(=O)OC(C)(C)C)nc1NCC=C |
| InChI | InChI=1S/C18H29N5O2/c1-8-9-21-16-15(12(4)19)13(11(2)3)10-14(22-16)23(20)17(24)25-18(5,6)7/h8,10-11,19H,1,9,20H2,2-7H3,(H,21,22)/b19-12+ |
| InChIKey | ZOQFGWLLICYCAZ-XDHOZWIPSA-N |
| XLogP | 3.81 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|