C19H36N6O2 — CID 144923728
tert-butyl N-[2-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]pentyl]-N-methylcarbamate;ethane (PubChem CID 144923728) has the molecular formula C19H36N6O2 and a molecular weight of 380.54 g/mol. Its IUPAC name is tert-butyl N-[2-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]pentyl]-N-methylcarbamate;ethane.
| Compound Name | tert-butyl N-[2-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]pentyl]-N-methylcarbamate;ethane |
|---|---|
| PubChem CID | 144923728 |
| Molecular Formula | C19H36N6O2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | tert-butyl N-[2-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]pentyl]-N-methylcarbamate;ethane |
| SMILES | CC.[H]/N=C(\C)c1c(N)ncnc1NC(CCC)CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30N6O2.C2H6/c1-7-8-12(9-23(6)16(24)25-17(3,4)5)22-15-13(11(2)18)14(19)20-10-21-15;1-2/h10,12,18H,7-9H2,1-6H3,(H3,19,20,21,22);1-2H3/b18-11+; |
| InChIKey | GSDGMPFUGDYXCT-NWBUNABESA-N |
| XLogP | 3.92 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|