C11H23NSi — CID 123573690
N-cyclopentyl-N,1-dimethylsilolan-1-amine (PubChem CID 123573690) has the molecular formula C11H23NSi and a molecular weight of 197.40 g/mol. Its IUPAC name is N-cyclopentyl-N,1-dimethylsilolan-1-amine.
| Compound Name | N-cyclopentyl-N,1-dimethylsilolan-1-amine |
|---|---|
| PubChem CID | 123573690 |
| Molecular Formula | C11H23NSi |
| Molecular Weight | 197.40 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | N-cyclopentyl-N,1-dimethylsilolan-1-amine |
| SMILES | CN(C1CCCC1)[Si]1(C)CCCC1 |
| InChI | InChI=1S/C11H23NSi/c1-12(11-7-3-4-8-11)13(2)9-5-6-10-13/h11H,3-10H2,1-2H3 |
| InChIKey | ZPTIIJBZDDCMCE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|