C14H28FNO3 — CID 123574616
tert-butyl N-(2-fluoro-6-methoxycyclohexyl)carbamate;ethane (PubChem CID 123574616) has the molecular formula C14H28FNO3 and a molecular weight of 277.38 g/mol. Its IUPAC name is tert-butyl N-(2-fluoro-6-methoxycyclohexyl)carbamate;ethane.
| Compound Name | tert-butyl N-(2-fluoro-6-methoxycyclohexyl)carbamate;ethane |
|---|---|
| PubChem CID | 123574616 |
| Molecular Formula | C14H28FNO3 |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.21 |
| IUPAC Name | tert-butyl N-(2-fluoro-6-methoxycyclohexyl)carbamate;ethane |
| SMILES | CC.COC1CCCC(F)C1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22FNO3.C2H6/c1-12(2,3)17-11(15)14-10-8(13)6-5-7-9(10)16-4;1-2/h8-10H,5-7H2,1-4H3,(H,14,15);1-2H3 |
| InChIKey | XEBQXEOQQMCONP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |