C26H33BN2O6S — CID 123583888
N-methyl-6-[methylsulfonyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]amino]-1-benzofuran-3-carboxamide (PubChem CID 123583888) has the molecular formula C26H33BN2O6S and a molecular weight of 512.44 g/mol. Its IUPAC name is N-methyl-6-[methylsulfonyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]amino]-1-benzofuran-3-carboxamide.
| Compound Name | N-methyl-6-[methylsulfonyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]amino]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 123583888 |
| Molecular Formula | C26H33BN2O6S |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | N-methyl-6-[methylsulfonyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]amino]-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1coc2cc(N(CC(C)c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)S(C)(=O)=O)ccc12 |
| InChI | InChI=1S/C26H33BN2O6S/c1-17(18-8-10-19(11-9-18)27-34-25(2,3)26(4,5)35-27)15-29(36(7,31)32)20-12-13-21-22(24(30)28-6)16-33-23(21)14-20/h8-14,16-17H,15H2,1-7H3,(H,28,30) |
| InChIKey | PBPGDAVLTDAXQB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|