C21H31BFNO6S — CID 171803713
N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonyl-5-methylfuran-3-carboxamide;molecular hydrogen;propane (PubChem CID 171803713) has the molecular formula C21H31BFNO6S and a molecular weight of 455.36 g/mol. Its IUPAC name is N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonyl-5-methylfuran-3-carboxamide;molecular hydrogen;propane.
| Compound Name | N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonyl-5-methylfuran-3-carboxamide;molecular hydrogen;propane |
|---|---|
| PubChem CID | 171803713 |
| Molecular Formula | C21H31BFNO6S |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonyl-5-methylfuran-3-carboxamide;molecular hydrogen;propane |
| SMILES | CCC.Cc1cc(C(=O)NS(=O)(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2F)co1.[H][H] |
| InChI | InChI=1S/C18H21BFNO6S.C3H8.H2/c1-11-8-12(10-25-11)16(22)21-28(23,24)15-7-6-13(9-14(15)20)19-26-17(2,3)18(4,5)27-19;1-3-2;/h6-10H,1-5H3,(H,21,22);3H2,1-2H3;1H |
| InChIKey | KKFYQWQLUBNHJJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|