C12H24N2O7S2 — CID 123584658
2-[3-[(2-hydroxy-3,3-dimethyl-4-methylsulfanyloxybutanoyl)amino]propanoylamino]ethanesulfonic acid (PubChem CID 123584658) has the molecular formula C12H24N2O7S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[3-[(2-hydroxy-3,3-dimethyl-4-methylsulfanyloxybutanoyl)amino]propanoylamino]ethanesulfonic acid.
| Compound Name | 2-[3-[(2-hydroxy-3,3-dimethyl-4-methylsulfanyloxybutanoyl)amino]propanoylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 123584658 |
| Molecular Formula | C12H24N2O7S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-[3-[(2-hydroxy-3,3-dimethyl-4-methylsulfanyloxybutanoyl)amino]propanoylamino]ethanesulfonic acid |
| SMILES | CSOCC(C)(C)C(O)C(=O)NCCC(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C12H24N2O7S2/c1-12(2,8-21-22-3)10(16)11(17)14-5-4-9(15)13-6-7-23(18,19)20/h10,16H,4-8H2,1-3H3,(H,13,15)(H,14,17)(H,18,19,20) |
| InChIKey | HWZDKNHDZBCACI-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|