C7H12S — CID 123585095
2,2-dimethyl-3,4-dihydrothiopyran (PubChem CID 123585095) has the molecular formula C7H12S and a molecular weight of 128.24 g/mol. Its IUPAC name is 2,2-dimethyl-3,4-dihydrothiopyran.
| Compound Name | 2,2-dimethyl-3,4-dihydrothiopyran |
|---|---|
| PubChem CID | 123585095 |
| Molecular Formula | C7H12S |
| Molecular Weight | 128.24 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 2,2-dimethyl-3,4-dihydrothiopyran |
| SMILES | CC1(C)CCC=CS1 |
| InChI | InChI=1S/C7H12S/c1-7(2)5-3-4-6-8-7/h4,6H,3,5H2,1-2H3 |
| InChIKey | NONBRZDNMOVDOU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |