C9H14O — CID 163995219
(2Z,7Z)-6,6-dimethyl-4,5-dihydrooxocine (PubChem CID 163995219) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (2Z,7Z)-6,6-dimethyl-4,5-dihydrooxocine.
| Compound Name | (2Z,7Z)-6,6-dimethyl-4,5-dihydrooxocine |
|---|---|
| PubChem CID | 163995219 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (2Z,7Z)-6,6-dimethyl-4,5-dihydrooxocine |
| SMILES | CC1(C)/C=C\O/C=C\CC1 |
| InChI | InChI=1S/C9H14O/c1-9(2)5-3-4-7-10-8-6-9/h4,6-8H,3,5H2,1-2H3/b7-4-,8-6- |
| InChIKey | SKRWPEUNLZTFFN-TXHKFLPISA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |