About 1-[2-(hydroxymethoxy)ethoxymethoxy]-3-methoxypropan-2-ol;oxaldehyde
1-[2-(hydroxymethoxy)ethoxymethoxy]-3-methoxypropan-2-ol;oxaldehyde (PubChem CID 123589036) has the molecular formula C10H20O8
and a molecular weight of 268.26 g/mol. Its IUPAC name is 1-[2-(hydroxymethoxy)ethoxymethoxy]-3-methoxypropan-2-ol;oxaldehyde.
Molecular Properties
| Compound Name | 1-[2-(hydroxymethoxy)ethoxymethoxy]-3-methoxypropan-2-ol;oxaldehyde |
| PubChem CID | 123589036 |
| Molecular Formula | C10H20O8 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-[2-(hydroxymethoxy)ethoxymethoxy]-3-methoxypropan-2-ol;oxaldehyde |
| SMILES | COCC(O)COCOCCOCO.O=CC=O |
| InChI | InChI=1S/C8H18O6.C2H2O2/c1-11-4-8(10)5-14-7-13-3-2-12-6-9;3-1-2-4/h8-10H,2-7H2,1H3;1-2H |
| InChIKey | QRBWMWDZQGNQHT-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(hydroxymethoxy)ethoxymethoxy]-3-methoxypropan-2-ol;oxaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(hydroxymethoxy)ethoxymethoxy]-3-methoxypropan-2-ol;oxaldehyde?
The IUPAC name of 1-[2-(hydroxymethoxy)ethoxymethoxy]-3-methoxypropan-2-ol;oxaldehyde (CID 123589036) is 1-[2-(hydroxymethoxy)ethoxymethoxy]-3-methoxypropan-2-ol;oxaldehyde.
What is the SMILES notation for 1-[2-(hydroxymethoxy)ethoxymethoxy]-3-methoxypropan-2-ol;oxaldehyde?
The canonical SMILES for 1-[2-(hydroxymethoxy)ethoxymethoxy]-3-methoxypropan-2-ol;oxaldehyde is COCC(O)COCOCCOCO.O=CC=O.
What is the InChIKey of 1-[2-(hydroxymethoxy)ethoxymethoxy]-3-methoxypropan-2-ol;oxaldehyde?
The InChIKey is QRBWMWDZQGNQHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O6.C2H2O2/c1-11-4-8(10)5-14-7-13-3-2-12-6-9;3-1-2-4/h8-10H,2-7H2,1H3;1-2H.
What are the key properties of 1-[2-(hydroxymethoxy)ethoxymethoxy]-3-methoxypropan-2-ol;oxaldehyde?
1-[2-(hydroxymethoxy)ethoxymethoxy]-3-methoxypropan-2-ol;oxaldehyde has a molecular weight of 268.26 g/mol, XLogP of -1.66, 11 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(hydroxymethoxy)ethoxymethoxy]-3-methoxypropan-2-ol;oxaldehyde is sourced from PubChem (CID 123589036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).