C15H22O5S — CID 123589856
2-(oxan-2-yloxy)ethyl 4-methylcyclohepta-1,3,5-triene-1-sulfonate (PubChem CID 123589856) has the molecular formula C15H22O5S and a molecular weight of 314.40 g/mol. Its IUPAC name is 2-(oxan-2-yloxy)ethyl 4-methylcyclohepta-1,3,5-triene-1-sulfonate.
| Compound Name | 2-(oxan-2-yloxy)ethyl 4-methylcyclohepta-1,3,5-triene-1-sulfonate |
|---|---|
| PubChem CID | 123589856 |
| Molecular Formula | C15H22O5S |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-(oxan-2-yloxy)ethyl 4-methylcyclohepta-1,3,5-triene-1-sulfonate |
| SMILES | CC1=CC=C(S(=O)(=O)OCCOC2CCCCO2)CC=C1 |
| InChI | InChI=1S/C15H22O5S/c1-13-5-4-6-14(9-8-13)21(16,17)20-12-11-19-15-7-2-3-10-18-15/h4-5,8-9,15H,2-3,6-7,10-12H2,1H3 |
| InChIKey | VZYKZJQTGZTGRM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|