C16H18O7 — CID 123589995
3,4-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3,4,4a,8,8a-hexahydrochromene-5,7-dione (PubChem CID 123589995) has the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. Its IUPAC name is 3,4-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3,4,4a,8,8a-hexahydrochromene-5,7-dione.
| Compound Name | 3,4-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3,4,4a,8,8a-hexahydrochromene-5,7-dione |
|---|---|
| PubChem CID | 123589995 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 3,4-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-2,3,4,4a,8,8a-hexahydrochromene-5,7-dione |
| SMILES | COc1cc(C2OC3CC(=O)CC(=O)C3C(O)C2O)ccc1O |
| InChI | InChI=1S/C16H18O7/c1-22-11-4-7(2-3-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-4,12-16,18,20-21H,5-6H2,1H3 |
| InChIKey | IIFBHIGDZOGFEC-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|