C16H22FNO — CID 123591526
N-(4-fluorophenyl)-4a-methyl-2,3,4,5,6,7,8,8a-octahydrochromen-5-amine (PubChem CID 123591526) has the molecular formula C16H22FNO and a molecular weight of 263.36 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4a-methyl-2,3,4,5,6,7,8,8a-octahydrochromen-5-amine.
| Compound Name | N-(4-fluorophenyl)-4a-methyl-2,3,4,5,6,7,8,8a-octahydrochromen-5-amine |
|---|---|
| PubChem CID | 123591526 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-(4-fluorophenyl)-4a-methyl-2,3,4,5,6,7,8,8a-octahydrochromen-5-amine |
| SMILES | CC12CCCOC1CCCC2Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H22FNO/c1-16-10-3-11-19-15(16)5-2-4-14(16)18-13-8-6-12(17)7-9-13/h6-9,14-15,18H,2-5,10-11H2,1H3 |
| InChIKey | VEJOENVYERLCGE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |