C20H29N3O5S — CID 123593229
tert-butyl (2R,3S)-2-[2-amino-1-(1H-indol-3-yl)ethyl]-3-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 123593229) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-[2-amino-1-(1H-indol-3-yl)ethyl]-3-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-2-[2-amino-1-(1H-indol-3-yl)ethyl]-3-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123593229 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | tert-butyl (2R,3S)-2-[2-amino-1-(1H-indol-3-yl)ethyl]-3-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](OS(C)(=O)=O)[C@H]1C(CN)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H29N3O5S/c1-20(2,3)27-19(24)23-10-9-17(28-29(4,25)26)18(23)14(11-21)15-12-22-16-8-6-5-7-13(15)16/h5-8,12,14,17-18,22H,9-11,21H2,1-4H3/t14?,17-,18+/m0/s1 |
| InChIKey | UBIHSJCRUCKROL-CXRLMVSZSA-N |
| XLogP | 2.56 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|