C13H21FN4O2 — CID 123594788
methyl 3-(azidomethyl)-8-(3-fluoropropyl)-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 123594788) has the molecular formula C13H21FN4O2 and a molecular weight of 284.33 g/mol. Its IUPAC name is methyl 3-(azidomethyl)-8-(3-fluoropropyl)-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl 3-(azidomethyl)-8-(3-fluoropropyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 123594788 |
| Molecular Formula | C13H21FN4O2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | methyl 3-(azidomethyl)-8-(3-fluoropropyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)C1C(CN=[N+]=[N-])CC2CCC1N2CCCF |
| InChI | InChI=1S/C13H21FN4O2/c1-20-13(19)12-9(8-16-17-15)7-10-3-4-11(12)18(10)6-2-5-14/h9-12H,2-8H2,1H3 |
| InChIKey | KQHYOOFJPLEBFE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|