C16H27O3P — CID 123597573
10-diethoxyphosphoryldodeca-1,3,5,7-tetraene (PubChem CID 123597573) has the molecular formula C16H27O3P and a molecular weight of 298.36 g/mol. Its IUPAC name is 10-diethoxyphosphoryldodeca-1,3,5,7-tetraene.
| Compound Name | 10-diethoxyphosphoryldodeca-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 123597573 |
| Molecular Formula | C16H27O3P |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 10-diethoxyphosphoryldodeca-1,3,5,7-tetraene |
| SMILES | C=CC=CC=CC=CCC(CC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H27O3P/c1-5-9-10-11-12-13-14-15-16(6-2)20(17,18-7-3)19-8-4/h5,9-14,16H,1,6-8,15H2,2-4H3 |
| InChIKey | GZMLPWCCVZLXQO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|