C17H38N+ — CID 123600184
trimethyl(3,3,6,7,8-pentamethylnonyl)azanium (PubChem CID 123600184) has the molecular formula C17H38N+ and a molecular weight of 256.50 g/mol. Its IUPAC name is trimethyl(3,3,6,7,8-pentamethylnonyl)azanium.
| Compound Name | trimethyl(3,3,6,7,8-pentamethylnonyl)azanium |
|---|---|
| PubChem CID | 123600184 |
| Molecular Formula | C17H38N+ |
| Molecular Weight | 256.50 g/mol |
| Exact Mass | 256.30 |
| IUPAC Name | trimethyl(3,3,6,7,8-pentamethylnonyl)azanium |
| SMILES | CC(C)C(C)C(C)CCC(C)(C)CC[N+](C)(C)C |
| InChI | InChI=1S/C17H38N/c1-14(2)16(4)15(3)10-11-17(5,6)12-13-18(7,8)9/h14-16H,10-13H2,1-9H3/q+1 |
| InChIKey | RJRXDTFMWBREIO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|