C24H34N2O3 — CID 123600450
1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-(3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl)pentan-1-one (PubChem CID 123600450) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-(3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl)pentan-1-one.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-(3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl)pentan-1-one |
|---|---|
| PubChem CID | 123600450 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-(3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-4-yl)pentan-1-one |
| SMILES | O=C(CCCCn1c(O)c2c(c1O)C1C=CC2CC1)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C24H34N2O3/c27-20(25-14-12-16-5-1-2-6-19(16)15-25)7-3-4-13-26-23(28)21-17-8-9-18(11-10-17)22(21)24(26)29/h8-9,16-19,28-29H,1-7,10-15H2 |
| InChIKey | JGSXVUQNGUALIC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|