C32H41NO3 — CID 123600766
17-(1-cyclopropylethyl)-N-[(2,4-dimethoxyphenyl)methyl]tetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide (PubChem CID 123600766) has the molecular formula C32H41NO3 and a molecular weight of 487.68 g/mol. Its IUPAC name is 17-(1-cyclopropylethyl)-N-[(2,4-dimethoxyphenyl)methyl]tetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide.
| Compound Name | 17-(1-cyclopropylethyl)-N-[(2,4-dimethoxyphenyl)methyl]tetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 123600766 |
| Molecular Formula | C32H41NO3 |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | 17-(1-cyclopropylethyl)-N-[(2,4-dimethoxyphenyl)methyl]tetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2ccc3c(c2)C24CCCCC2C(C3)C(C(C)C2CC2)CC4)c(OC)c1 |
| InChI | InChI=1S/C32H41NO3/c1-20(21-7-8-21)26-13-15-32-14-5-4-6-28(32)27(26)16-22-9-10-23(17-29(22)32)31(34)33-19-24-11-12-25(35-2)18-30(24)36-3/h9-12,17-18,20-21,26-28H,4-8,13-16,19H2,1-3H3,(H,33,34) |
| InChIKey | YWNLRZUZEKAXGB-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |