C28H32N2O8 — CID 123601726
propyl 5-[[(4-methylphenyl)methylidenehydrazinylidene]methyl]-2-[4-oxo-4-(2-prop-2-enoyloxyethoxy)butyl]peroxybenzoate (PubChem CID 123601726) has the molecular formula C28H32N2O8 and a molecular weight of 524.57 g/mol. Its IUPAC name is propyl 5-[[(4-methylphenyl)methylidenehydrazinylidene]methyl]-2-[4-oxo-4-(2-prop-2-enoyloxyethoxy)butyl]peroxybenzoate.
| Compound Name | propyl 5-[[(4-methylphenyl)methylidenehydrazinylidene]methyl]-2-[4-oxo-4-(2-prop-2-enoyloxyethoxy)butyl]peroxybenzoate |
|---|---|
| PubChem CID | 123601726 |
| Molecular Formula | C28H32N2O8 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | propyl 5-[[(4-methylphenyl)methylidenehydrazinylidene]methyl]-2-[4-oxo-4-(2-prop-2-enoyloxyethoxy)butyl]peroxybenzoate |
| SMILES | C=CC(=O)OCCOC(=O)CCCOOc1ccc(C=NN=Cc2ccc(C)cc2)cc1C(=O)OCCC |
| InChI | InChI=1S/C28H32N2O8/c1-4-14-36-28(33)24-18-23(20-30-29-19-22-10-8-21(3)9-11-22)12-13-25(24)38-37-15-6-7-27(32)35-17-16-34-26(31)5-2/h5,8-13,18-20H,2,4,6-7,14-17H2,1,3H3 |
| InChIKey | XSNJJWGXJMZAAR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 122.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|