C22H25N5O4 — CID 123604955
2-[(8-acetamido-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]-N-(1-methoxyethyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 123604955) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-[(8-acetamido-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]-N-(1-methoxyethyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[(8-acetamido-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]-N-(1-methoxyethyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 123604955 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 2-[(8-acetamido-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]-N-(1-methoxyethyl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | COC(C)NC(=O)c1c[nH]c2ncc(Oc3ccc4c(c3)C(NC(C)=O)CCC4)nc12 |
| InChI | InChI=1S/C22H25N5O4/c1-12(28)25-18-6-4-5-14-7-8-15(9-16(14)18)31-19-11-24-21-20(27-19)17(10-23-21)22(29)26-13(2)30-3/h7-11,13,18H,4-6H2,1-3H3,(H,23,24)(H,25,28)(H,26,29) |
| InChIKey | HCJQJAJYEGEHEF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|