C18H22NO4+ — CID 123610644
(1S,5R,14R,15S,18R)-4,4-dimethyl-9,13-dioxa-4-azoniahexacyclo[10.6.1.01,14.05,18.07,19.08,10]nonadeca-7(19),11,16-triene-11,15-diol (PubChem CID 123610644) has the molecular formula C18H22NO4+ and a molecular weight of 316.38 g/mol. Its IUPAC name is (1S,5R,14R,15S,18R)-4,4-dimethyl-9,13-dioxa-4-azoniahexacyclo[10.6.1.01,14.05,18.07,19.08,10]nonadeca-7(19),11,16-triene-11,15-diol.
| Compound Name | (1S,5R,14R,15S,18R)-4,4-dimethyl-9,13-dioxa-4-azoniahexacyclo[10.6.1.01,14.05,18.07,19.08,10]nonadeca-7(19),11,16-triene-11,15-diol |
|---|---|
| PubChem CID | 123610644 |
| Molecular Formula | C18H22NO4+ |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (1S,5R,14R,15S,18R)-4,4-dimethyl-9,13-dioxa-4-azoniahexacyclo[10.6.1.01,14.05,18.07,19.08,10]nonadeca-7(19),11,16-triene-11,15-diol |
| SMILES | C[N+]1(C)CC[C@@]23C4=C5C[C@@H]1[C@@H]2C=C[C@H](O)[C@@H]3OC4=C(O)C1OC51 |
| InChI | InChI=1S/C18H21NO4/c1-19(2)6-5-18-9-3-4-11(20)17(18)23-15-12(18)8(7-10(9)19)14-16(22-14)13(15)21/h3-4,9-11,14,16-17,20H,5-7H2,1-2H3/p+1/t9-,10+,11-,14?,16?,17-,18-/m0/s1 |
| InChIKey | JNFONHJVCCEVJT-FNYUNQQMSA-O |
| XLogP | 1.02 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|