C13H14F6O8S — CID 123614208
[2,2-difluoro-2-[1,1,1-trifluoro-3-(2-methyl-1,3-dioxan-2-yl)propan-2-yl]oxysulfonylacetyl] 2-fluoroprop-2-enoate (PubChem CID 123614208) has the molecular formula C13H14F6O8S and a molecular weight of 444.30 g/mol. Its IUPAC name is [2,2-difluoro-2-[1,1,1-trifluoro-3-(2-methyl-1,3-dioxan-2-yl)propan-2-yl]oxysulfonylacetyl] 2-fluoroprop-2-enoate.
| Compound Name | [2,2-difluoro-2-[1,1,1-trifluoro-3-(2-methyl-1,3-dioxan-2-yl)propan-2-yl]oxysulfonylacetyl] 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 123614208 |
| Molecular Formula | C13H14F6O8S |
| Molecular Weight | 444.30 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | [2,2-difluoro-2-[1,1,1-trifluoro-3-(2-methyl-1,3-dioxan-2-yl)propan-2-yl]oxysulfonylacetyl] 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)OC(=O)C(F)(F)S(=O)(=O)OC(CC1(C)OCCCO1)C(F)(F)F |
| InChI | InChI=1S/C13H14F6O8S/c1-7(14)9(20)26-10(21)13(18,19)28(22,23)27-8(12(15,16)17)6-11(2)24-4-3-5-25-11/h8H,1,3-6H2,2H3 |
| InChIKey | SVYDAHIDXIHXHH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|