C20H27F5O7S — CID 123328800
1-adamantyl 2,2-difluoro-2-[1,1,1-trifluoro-3-(2-methyl-1,3-dioxan-2-yl)propan-2-yl]oxysulfonylacetate (PubChem CID 123328800) has the molecular formula C20H27F5O7S and a molecular weight of 506.49 g/mol. Its IUPAC name is 1-adamantyl 2,2-difluoro-2-[1,1,1-trifluoro-3-(2-methyl-1,3-dioxan-2-yl)propan-2-yl]oxysulfonylacetate.
| Compound Name | 1-adamantyl 2,2-difluoro-2-[1,1,1-trifluoro-3-(2-methyl-1,3-dioxan-2-yl)propan-2-yl]oxysulfonylacetate |
|---|---|
| PubChem CID | 123328800 |
| Molecular Formula | C20H27F5O7S |
| Molecular Weight | 506.49 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 1-adamantyl 2,2-difluoro-2-[1,1,1-trifluoro-3-(2-methyl-1,3-dioxan-2-yl)propan-2-yl]oxysulfonylacetate |
| SMILES | CC1(CC(OS(=O)(=O)C(F)(F)C(=O)OC23CC4CC(CC(C4)C2)C3)C(F)(F)F)OCCCO1 |
| InChI | InChI=1S/C20H27F5O7S/c1-17(29-3-2-4-30-17)11-15(19(21,22)23)32-33(27,28)20(24,25)16(26)31-18-8-12-5-13(9-18)7-14(6-12)10-18/h12-15H,2-11H2,1H3 |
| InChIKey | XIAAVFFCLXAPRW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|