C21H23FN6S — CID 123614487
2-[3-[(4aR,7aS)-2-amino-6-pyrazin-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]phenyl]-N-methylbut-2-enimidoyl fluoride (PubChem CID 123614487) has the molecular formula C21H23FN6S and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[3-[(4aR,7aS)-2-amino-6-pyrazin-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]phenyl]-N-methylbut-2-enimidoyl fluoride.
| Compound Name | 2-[3-[(4aR,7aS)-2-amino-6-pyrazin-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]phenyl]-N-methylbut-2-enimidoyl fluoride |
|---|---|
| PubChem CID | 123614487 |
| Molecular Formula | C21H23FN6S |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-[3-[(4aR,7aS)-2-amino-6-pyrazin-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]phenyl]-N-methylbut-2-enimidoyl fluoride |
| SMILES | CC=C(/C(F)=N/C)c1cccc([C@]23CN(c4cnccn4)C[C@H]2CSC(N)=N3)c1 |
| InChI | InChI=1S/C21H23FN6S/c1-3-17(19(22)24-2)14-5-4-6-15(9-14)21-13-28(18-10-25-7-8-26-18)11-16(21)12-29-20(23)27-21/h3-10,16H,11-13H2,1-2H3,(H2,23,27)/b17-3?,24-19-/t16-,21+/m0/s1 |
| InChIKey | LCBNVMCFABXIFE-WBLDXERQSA-N |
| XLogP | 3.27 |
| TPSA | 79.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|