C18H19FN6OS2 — CID 90265829
5-[(4aR)-2-amino-6-[5-fluoro-4-(2-hydroxypropan-2-yl)pyrimidin-2-yl]-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]thiophene-2-carbonitrile (PubChem CID 90265829) has the molecular formula C18H19FN6OS2 and a molecular weight of 418.52 g/mol. Its IUPAC name is 5-[(4aR)-2-amino-6-[5-fluoro-4-(2-hydroxypropan-2-yl)pyrimidin-2-yl]-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]thiophene-2-carbonitrile.
| Compound Name | 5-[(4aR)-2-amino-6-[5-fluoro-4-(2-hydroxypropan-2-yl)pyrimidin-2-yl]-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 90265829 |
| Molecular Formula | C18H19FN6OS2 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 5-[(4aR)-2-amino-6-[5-fluoro-4-(2-hydroxypropan-2-yl)pyrimidin-2-yl]-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]thiophene-2-carbonitrile |
| SMILES | CC(C)(O)c1nc(N2C[C@H]3CSC(N)=NC3(c3ccc(C#N)s3)C2)ncc1F |
| InChI | InChI=1S/C18H19FN6OS2/c1-17(2,26)14-12(19)6-22-16(23-14)25-7-10-8-27-15(21)24-18(10,9-25)13-4-3-11(5-20)28-13/h3-4,6,10,26H,7-9H2,1-2H3,(H2,21,24)/t10-,18?/m0/s1 |
| InChIKey | PSISLQASRWQQAL-APDXDRDNSA-N |
| XLogP | 2.17 |
| TPSA | 111.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |