C16H19FN6S2 — CID 90265852
(4aR)-6-(5-fluoro-4-propan-2-ylpyrimidin-2-yl)-7a-(1,3-thiazol-5-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine (PubChem CID 90265852) has the molecular formula C16H19FN6S2 and a molecular weight of 378.50 g/mol. Its IUPAC name is (4aR)-6-(5-fluoro-4-propan-2-ylpyrimidin-2-yl)-7a-(1,3-thiazol-5-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR)-6-(5-fluoro-4-propan-2-ylpyrimidin-2-yl)-7a-(1,3-thiazol-5-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 90265852 |
| Molecular Formula | C16H19FN6S2 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | (4aR)-6-(5-fluoro-4-propan-2-ylpyrimidin-2-yl)-7a-(1,3-thiazol-5-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine |
| SMILES | CC(C)c1nc(N2C[C@H]3CSC(N)=NC3(c3cncs3)C2)ncc1F |
| InChI | InChI=1S/C16H19FN6S2/c1-9(2)13-11(17)3-20-15(21-13)23-5-10-6-24-14(18)22-16(10,7-23)12-4-19-8-25-12/h3-4,8-10H,5-7H2,1-2H3,(H2,18,22)/t10-,16?/m0/s1 |
| InChIKey | SJZLCMQTMYEQDB-VQVVDHBBSA-N |
| XLogP | 2.59 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |