C14H15ClFN5S2 — CID 86762253
(4aR,7aR)-7a-(5-fluorothiophen-2-yl)-6-pyrimidin-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine;hydrochloride (PubChem CID 86762253) has the molecular formula C14H15ClFN5S2 and a molecular weight of 371.89 g/mol. Its IUPAC name is (4aR,7aR)-7a-(5-fluorothiophen-2-yl)-6-pyrimidin-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine;hydrochloride.
| Compound Name | (4aR,7aR)-7a-(5-fluorothiophen-2-yl)-6-pyrimidin-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 86762253 |
| Molecular Formula | C14H15ClFN5S2 |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | (4aR,7aR)-7a-(5-fluorothiophen-2-yl)-6-pyrimidin-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine;hydrochloride |
| SMILES | Cl.NC1=N[C@@]2(c3ccc(F)s3)CN(c3ncccn3)C[C@H]2CS1 |
| InChI | InChI=1S/C14H14FN5S2.ClH/c15-11-3-2-10(22-11)14-8-20(13-17-4-1-5-18-13)6-9(14)7-21-12(16)19-14;/h1-5,9H,6-8H2,(H2,16,19);1H/t9-,14-;/m0./s1 |
| InChIKey | TUHUDMVBQNIPRX-HDWCWOBCSA-N |
| XLogP | 2.49 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |